C17H25N7 — CID 126894005
2-[4-[1-[2-(2-methylpyrazol-3-yl)ethyl]azetidin-3-yl]piperazin-1-yl]pyrimidine (PubChem CID 126894005) has the molecular formula C17H25N7 and a molecular weight of 327.44 g/mol. Its IUPAC name is 2-[4-[1-[2-(2-methylpyrazol-3-yl)ethyl]azetidin-3-yl]piperazin-1-yl]pyrimidine.
| Compound Name | 2-[4-[1-[2-(2-methylpyrazol-3-yl)ethyl]azetidin-3-yl]piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 126894005 |
| Molecular Formula | C17H25N7 |
| Molecular Weight | 327.44 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 2-[4-[1-[2-(2-methylpyrazol-3-yl)ethyl]azetidin-3-yl]piperazin-1-yl]pyrimidine |
| SMILES | Cn1nccc1CCN1CC(N2CCN(c3ncccn3)CC2)C1 |
| InChI | InChI=1S/C17H25N7/c1-21-15(3-7-20-21)4-8-22-13-16(14-22)23-9-11-24(12-10-23)17-18-5-2-6-19-17/h2-3,5-7,16H,4,8-14H2,1H3 |
| InChIKey | KJYLZUYWXXATLF-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 53.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.44 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |