C21H27N7O — CID 126894808
3-[[4-(4-methoxyquinazolin-6-yl)piperazin-1-yl]methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine (PubChem CID 126894808) has the molecular formula C21H27N7O and a molecular weight of 393.50 g/mol. Its IUPAC name is 3-[[4-(4-methoxyquinazolin-6-yl)piperazin-1-yl]methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine.
| Compound Name | 3-[[4-(4-methoxyquinazolin-6-yl)piperazin-1-yl]methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
|---|---|
| PubChem CID | 126894808 |
| Molecular Formula | C21H27N7O |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 3-[[4-(4-methoxyquinazolin-6-yl)piperazin-1-yl]methyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
| SMILES | COc1ncnc2ccc(N3CCN(Cc4nnc5n4CCCCC5)CC3)cc12 |
| InChI | InChI=1S/C21H27N7O/c1-29-21-17-13-16(6-7-18(17)22-15-23-21)27-11-9-26(10-12-27)14-20-25-24-19-5-3-2-4-8-28(19)20/h6-7,13,15H,2-5,8-12,14H2,1H3 |
| InChIKey | DYOWAFCHSLPSMH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 72.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |