C20H22N6O — CID 126894896
6-[4-(3-cyclopropylpyrazin-2-yl)piperazin-1-yl]-4-methoxyquinazoline (PubChem CID 126894896) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is 6-[4-(3-cyclopropylpyrazin-2-yl)piperazin-1-yl]-4-methoxyquinazoline.
| Compound Name | 6-[4-(3-cyclopropylpyrazin-2-yl)piperazin-1-yl]-4-methoxyquinazoline |
|---|---|
| PubChem CID | 126894896 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 6-[4-(3-cyclopropylpyrazin-2-yl)piperazin-1-yl]-4-methoxyquinazoline |
| SMILES | COc1ncnc2ccc(N3CCN(c4nccnc4C4CC4)CC3)cc12 |
| InChI | InChI=1S/C20H22N6O/c1-27-20-16-12-15(4-5-17(16)23-13-24-20)25-8-10-26(11-9-25)19-18(14-2-3-14)21-6-7-22-19/h4-7,12-14H,2-3,8-11H2,1H3 |
| InChIKey | NHUAPCDFCOXDHA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 67.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |