C19H19N7O — CID 126894707
4-methoxy-6-(4-pyrazolo[1,5-a]pyrazin-4-ylpiperazin-1-yl)quinazoline (PubChem CID 126894707) has the molecular formula C19H19N7O and a molecular weight of 361.41 g/mol. Its IUPAC name is 4-methoxy-6-(4-pyrazolo[1,5-a]pyrazin-4-ylpiperazin-1-yl)quinazoline.
| Compound Name | 4-methoxy-6-(4-pyrazolo[1,5-a]pyrazin-4-ylpiperazin-1-yl)quinazoline |
|---|---|
| PubChem CID | 126894707 |
| Molecular Formula | C19H19N7O |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 4-methoxy-6-(4-pyrazolo[1,5-a]pyrazin-4-ylpiperazin-1-yl)quinazoline |
| SMILES | COc1ncnc2ccc(N3CCN(c4nccn5nccc45)CC3)cc12 |
| InChI | InChI=1S/C19H19N7O/c1-27-19-15-12-14(2-3-16(15)21-13-22-19)24-8-10-25(11-9-24)18-17-4-5-23-26(17)7-6-20-18/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | JOTNORBTGCNBTN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 71.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |