C19H20N6O2 — CID 126894625
[4-(4-methoxyquinazolin-6-yl)piperazin-1-yl]-(5-methylpyrazin-2-yl)methanone (PubChem CID 126894625) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is [4-(4-methoxyquinazolin-6-yl)piperazin-1-yl]-(5-methylpyrazin-2-yl)methanone.
| Compound Name | [4-(4-methoxyquinazolin-6-yl)piperazin-1-yl]-(5-methylpyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 126894625 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | [4-(4-methoxyquinazolin-6-yl)piperazin-1-yl]-(5-methylpyrazin-2-yl)methanone |
| SMILES | COc1ncnc2ccc(N3CCN(C(=O)c4cnc(C)cn4)CC3)cc12 |
| InChI | InChI=1S/C19H20N6O2/c1-13-10-21-17(11-20-13)19(26)25-7-5-24(6-8-25)14-3-4-16-15(9-14)18(27-2)23-12-22-16/h3-4,9-12H,5-8H2,1-2H3 |
| InChIKey | JZUQYWDXPYMMFT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 84.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |