C20H23N7O2 — CID 126895487
[4-(4-cyclopentyloxyquinazolin-6-yl)piperazin-1-yl]-(2H-triazol-4-yl)methanone (PubChem CID 126895487) has the molecular formula C20H23N7O2 and a molecular weight of 393.45 g/mol. Its IUPAC name is [4-(4-cyclopentyloxyquinazolin-6-yl)piperazin-1-yl]-(2H-triazol-4-yl)methanone.
| Compound Name | [4-(4-cyclopentyloxyquinazolin-6-yl)piperazin-1-yl]-(2H-triazol-4-yl)methanone |
|---|---|
| PubChem CID | 126895487 |
| Molecular Formula | C20H23N7O2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | [4-(4-cyclopentyloxyquinazolin-6-yl)piperazin-1-yl]-(2H-triazol-4-yl)methanone |
| SMILES | O=C(c1cn[nH]n1)N1CCN(c2ccc3ncnc(OC4CCCC4)c3c2)CC1 |
| InChI | InChI=1S/C20H23N7O2/c28-20(18-12-23-25-24-18)27-9-7-26(8-10-27)14-5-6-17-16(11-14)19(22-13-21-17)29-15-3-1-2-4-15/h5-6,11-13,15H,1-4,7-10H2,(H,23,24,25) |
| InChIKey | FOVRFOHVPGPBDK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |