C21H27N5O3 — CID 126896267
[4-[4-(cyclopropylmethoxy)quinazolin-6-yl]piperazin-1-yl]-morpholin-4-ylmethanone (PubChem CID 126896267) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is [4-[4-(cyclopropylmethoxy)quinazolin-6-yl]piperazin-1-yl]-morpholin-4-ylmethanone.
| Compound Name | [4-[4-(cyclopropylmethoxy)quinazolin-6-yl]piperazin-1-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 126896267 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | [4-[4-(cyclopropylmethoxy)quinazolin-6-yl]piperazin-1-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(N1CCOCC1)N1CCN(c2ccc3ncnc(OCC4CC4)c3c2)CC1 |
| InChI | InChI=1S/C21H27N5O3/c27-21(26-9-11-28-12-10-26)25-7-5-24(6-8-25)17-3-4-19-18(13-17)20(23-15-22-19)29-14-16-1-2-16/h3-4,13,15-16H,1-2,5-12,14H2 |
| InChIKey | JKFDMTHVLQBYPN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |