C20H22N6O3 — CID 126896615
[4-[4-(oxolan-3-yloxy)quinazolin-6-yl]piperazin-1-yl]-(1H-pyrazol-4-yl)methanone (PubChem CID 126896615) has the molecular formula C20H22N6O3 and a molecular weight of 394.44 g/mol. Its IUPAC name is [4-[4-(oxolan-3-yloxy)quinazolin-6-yl]piperazin-1-yl]-(1H-pyrazol-4-yl)methanone.
| Compound Name | [4-[4-(oxolan-3-yloxy)quinazolin-6-yl]piperazin-1-yl]-(1H-pyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 126896615 |
| Molecular Formula | C20H22N6O3 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | [4-[4-(oxolan-3-yloxy)quinazolin-6-yl]piperazin-1-yl]-(1H-pyrazol-4-yl)methanone |
| SMILES | O=C(c1cn[nH]c1)N1CCN(c2ccc3ncnc(OC4CCOC4)c3c2)CC1 |
| InChI | InChI=1S/C20H22N6O3/c27-20(14-10-23-24-11-14)26-6-4-25(5-7-26)15-1-2-18-17(9-15)19(22-13-21-18)29-16-3-8-28-12-16/h1-2,9-11,13,16H,3-8,12H2,(H,23,24) |
| InChIKey | YGZSEIUUIYGCDG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |