C22H31N5O3 — CID 126894924
1-[3-hydroxy-3-[[4-(4-methoxyquinazolin-6-yl)piperazin-1-yl]methyl]azepan-1-yl]ethanone (PubChem CID 126894924) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is 1-[3-hydroxy-3-[[4-(4-methoxyquinazolin-6-yl)piperazin-1-yl]methyl]azepan-1-yl]ethanone.
| Compound Name | 1-[3-hydroxy-3-[[4-(4-methoxyquinazolin-6-yl)piperazin-1-yl]methyl]azepan-1-yl]ethanone |
|---|---|
| PubChem CID | 126894924 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 1-[3-hydroxy-3-[[4-(4-methoxyquinazolin-6-yl)piperazin-1-yl]methyl]azepan-1-yl]ethanone |
| SMILES | COc1ncnc2ccc(N3CCN(CC4(O)CCCCN(C(C)=O)C4)CC3)cc12 |
| InChI | InChI=1S/C22H31N5O3/c1-17(28)27-8-4-3-7-22(29,15-27)14-25-9-11-26(12-10-25)18-5-6-20-19(13-18)21(30-2)24-16-23-20/h5-6,13,16,29H,3-4,7-12,14-15H2,1-2H3 |
| InChIKey | NVHYVBLCTNDDRU-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |