C20H25N7O — CID 126895783
4-[[4-[4-(dimethylamino)quinazolin-6-yl]piperazin-1-yl]methyl]-2-methylpyridazin-3-one (PubChem CID 126895783) has the molecular formula C20H25N7O and a molecular weight of 379.47 g/mol. Its IUPAC name is 4-[[4-[4-(dimethylamino)quinazolin-6-yl]piperazin-1-yl]methyl]-2-methylpyridazin-3-one.
| Compound Name | 4-[[4-[4-(dimethylamino)quinazolin-6-yl]piperazin-1-yl]methyl]-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 126895783 |
| Molecular Formula | C20H25N7O |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 4-[[4-[4-(dimethylamino)quinazolin-6-yl]piperazin-1-yl]methyl]-2-methylpyridazin-3-one |
| SMILES | CN(C)c1ncnc2ccc(N3CCN(Cc4ccnn(C)c4=O)CC3)cc12 |
| InChI | InChI=1S/C20H25N7O/c1-24(2)19-17-12-16(4-5-18(17)21-14-22-19)27-10-8-26(9-11-27)13-15-6-7-23-25(3)20(15)28/h4-7,12,14H,8-11,13H2,1-3H3 |
| InChIKey | LFIARSDRFWEJKB-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 70.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |