C18H21N7 — CID 126895928
N,N-dimethyl-6-(4-pyrimidin-4-ylpiperazin-1-yl)quinazolin-4-amine (PubChem CID 126895928) has the molecular formula C18H21N7 and a molecular weight of 335.42 g/mol. Its IUPAC name is N,N-dimethyl-6-(4-pyrimidin-4-ylpiperazin-1-yl)quinazolin-4-amine.
| Compound Name | N,N-dimethyl-6-(4-pyrimidin-4-ylpiperazin-1-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 126895928 |
| Molecular Formula | C18H21N7 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | N,N-dimethyl-6-(4-pyrimidin-4-ylpiperazin-1-yl)quinazolin-4-amine |
| SMILES | CN(C)c1ncnc2ccc(N3CCN(c4ccncn4)CC3)cc12 |
| InChI | InChI=1S/C18H21N7/c1-23(2)18-15-11-14(3-4-16(15)20-13-22-18)24-7-9-25(10-8-24)17-5-6-19-12-21-17/h3-6,11-13H,7-10H2,1-2H3 |
| InChIKey | BPZKTDDUDUWERO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 61.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |