C21H22N8 — CID 126896066
3-[4-(4-pyrrolidin-1-ylquinazolin-6-yl)piperazin-1-yl]pyrazine-2-carbonitrile (PubChem CID 126896066) has the molecular formula C21H22N8 and a molecular weight of 386.46 g/mol. Its IUPAC name is 3-[4-(4-pyrrolidin-1-ylquinazolin-6-yl)piperazin-1-yl]pyrazine-2-carbonitrile.
| Compound Name | 3-[4-(4-pyrrolidin-1-ylquinazolin-6-yl)piperazin-1-yl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 126896066 |
| Molecular Formula | C21H22N8 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 3-[4-(4-pyrrolidin-1-ylquinazolin-6-yl)piperazin-1-yl]pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1N1CCN(c2ccc3ncnc(N4CCCC4)c3c2)CC1 |
| InChI | InChI=1S/C21H22N8/c22-14-19-21(24-6-5-23-19)29-11-9-27(10-12-29)16-3-4-18-17(13-16)20(26-15-25-18)28-7-1-2-8-28/h3-6,13,15H,1-2,7-12H2 |
| InChIKey | YADUOACXTQAZKE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 85.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |