C22H32N6O2S — CID 126896112
6-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-4-pyrrolidin-1-ylquinazoline (PubChem CID 126896112) has the molecular formula C22H32N6O2S and a molecular weight of 444.61 g/mol. Its IUPAC name is 6-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-4-pyrrolidin-1-ylquinazoline.
| Compound Name | 6-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-4-pyrrolidin-1-ylquinazoline |
|---|---|
| PubChem CID | 126896112 |
| Molecular Formula | C22H32N6O2S |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 6-[4-(azepan-1-ylsulfonyl)piperazin-1-yl]-4-pyrrolidin-1-ylquinazoline |
| SMILES | O=S(=O)(N1CCCCCC1)N1CCN(c2ccc3ncnc(N4CCCC4)c3c2)CC1 |
| InChI | InChI=1S/C22H32N6O2S/c29-31(30,27-11-3-1-2-4-12-27)28-15-13-25(14-16-28)19-7-8-21-20(17-19)22(24-18-23-21)26-9-5-6-10-26/h7-8,17-18H,1-6,9-16H2 |
| InChIKey | GBLAXIWNYDBBGL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 72.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |