C23H32N6O — CID 126896117
7-[[4-(4-pyrrolidin-1-ylquinazolin-6-yl)piperazin-1-yl]methyl]azepan-2-one (PubChem CID 126896117) has the molecular formula C23H32N6O and a molecular weight of 408.55 g/mol. Its IUPAC name is 7-[[4-(4-pyrrolidin-1-ylquinazolin-6-yl)piperazin-1-yl]methyl]azepan-2-one.
| Compound Name | 7-[[4-(4-pyrrolidin-1-ylquinazolin-6-yl)piperazin-1-yl]methyl]azepan-2-one |
|---|---|
| PubChem CID | 126896117 |
| Molecular Formula | C23H32N6O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | 7-[[4-(4-pyrrolidin-1-ylquinazolin-6-yl)piperazin-1-yl]methyl]azepan-2-one |
| SMILES | O=C1CCCCC(CN2CCN(c3ccc4ncnc(N5CCCC5)c4c3)CC2)N1 |
| InChI | InChI=1S/C23H32N6O/c30-22-6-2-1-5-18(26-22)16-27-11-13-28(14-12-27)19-7-8-21-20(15-19)23(25-17-24-21)29-9-3-4-10-29/h7-8,15,17-18H,1-6,9-14,16H2,(H,26,30) |
| InChIKey | PADNUPWVAWGMQI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |