C20H21BrN4O2S — CID 22031431
6-bromo-4-[4-(3-methylsulfonylphenyl)-1,4-diazepan-1-yl]quinazoline (PubChem CID 22031431) has the molecular formula C20H21BrN4O2S and a molecular weight of 461.39 g/mol. Its IUPAC name is 6-bromo-4-[4-(3-methylsulfonylphenyl)-1,4-diazepan-1-yl]quinazoline.
| Compound Name | 6-bromo-4-[4-(3-methylsulfonylphenyl)-1,4-diazepan-1-yl]quinazoline |
|---|---|
| PubChem CID | 22031431 |
| Molecular Formula | C20H21BrN4O2S |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | 6-bromo-4-[4-(3-methylsulfonylphenyl)-1,4-diazepan-1-yl]quinazoline |
| SMILES | CS(=O)(=O)c1cccc(N2CCCN(c3ncnc4ccc(Br)cc34)CC2)c1 |
| InChI | InChI=1S/C20H21BrN4O2S/c1-28(26,27)17-5-2-4-16(13-17)24-8-3-9-25(11-10-24)20-18-12-15(21)6-7-19(18)22-14-23-20/h2,4-7,12-14H,3,8-11H2,1H3 |
| InChIKey | HYOKQMQHJLXXHU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |