C18H15BrF2N4 — CID 170641448
6-bromo-4-[4-(2,4-difluorophenyl)piperazin-1-yl]quinazoline (PubChem CID 170641448) has the molecular formula C18H15BrF2N4 and a molecular weight of 405.25 g/mol. Its IUPAC name is 6-bromo-4-[4-(2,4-difluorophenyl)piperazin-1-yl]quinazoline.
| Compound Name | 6-bromo-4-[4-(2,4-difluorophenyl)piperazin-1-yl]quinazoline |
|---|---|
| PubChem CID | 170641448 |
| Molecular Formula | C18H15BrF2N4 |
| Molecular Weight | 405.25 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 6-bromo-4-[4-(2,4-difluorophenyl)piperazin-1-yl]quinazoline |
| SMILES | Fc1ccc(N2CCN(c3ncnc4ccc(Br)cc34)CC2)c(F)c1 |
| InChI | InChI=1S/C18H15BrF2N4/c19-12-1-3-16-14(9-12)18(23-11-22-16)25-7-5-24(6-8-25)17-4-2-13(20)10-15(17)21/h1-4,9-11H,5-8H2 |
| InChIKey | XHNUHXKWLMYNNH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.25 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |