C18H17F3N6O — CID 126896965
3-methyl-7-[4-[6-(trifluoromethyl)pyridazin-3-yl]piperazin-1-yl]quinazolin-4-one (PubChem CID 126896965) has the molecular formula C18H17F3N6O and a molecular weight of 390.37 g/mol. Its IUPAC name is 3-methyl-7-[4-[6-(trifluoromethyl)pyridazin-3-yl]piperazin-1-yl]quinazolin-4-one.
| Compound Name | 3-methyl-7-[4-[6-(trifluoromethyl)pyridazin-3-yl]piperazin-1-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 126896965 |
| Molecular Formula | C18H17F3N6O |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 3-methyl-7-[4-[6-(trifluoromethyl)pyridazin-3-yl]piperazin-1-yl]quinazolin-4-one |
| SMILES | Cn1cnc2cc(N3CCN(c4ccc(C(F)(F)F)nn4)CC3)ccc2c1=O |
| InChI | InChI=1S/C18H17F3N6O/c1-25-11-22-14-10-12(2-3-13(14)17(25)28)26-6-8-27(9-7-26)16-5-4-15(23-24-16)18(19,20)21/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | YTOJJWSKNGBEBW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |