C19H22N6O2 — CID 126898635
3-(2-hydroxyethyl)-7-[4-(6-methylpyridazin-3-yl)piperazin-1-yl]quinazolin-4-one (PubChem CID 126898635) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-7-[4-(6-methylpyridazin-3-yl)piperazin-1-yl]quinazolin-4-one.
| Compound Name | 3-(2-hydroxyethyl)-7-[4-(6-methylpyridazin-3-yl)piperazin-1-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 126898635 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 3-(2-hydroxyethyl)-7-[4-(6-methylpyridazin-3-yl)piperazin-1-yl]quinazolin-4-one |
| SMILES | Cc1ccc(N2CCN(c3ccc4c(=O)n(CCO)cnc4c3)CC2)nn1 |
| InChI | InChI=1S/C19H22N6O2/c1-14-2-5-18(22-21-14)24-8-6-23(7-9-24)15-3-4-16-17(12-15)20-13-25(10-11-26)19(16)27/h2-5,12-13,26H,6-11H2,1H3 |
| InChIKey | QCPIEXAWTHTDFY-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |