C17H24N4O3 — CID 126898641
3-(2-hydroxyethyl)-7-[4-(2-methoxyethyl)piperazin-1-yl]quinazolin-4-one (PubChem CID 126898641) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-7-[4-(2-methoxyethyl)piperazin-1-yl]quinazolin-4-one.
| Compound Name | 3-(2-hydroxyethyl)-7-[4-(2-methoxyethyl)piperazin-1-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 126898641 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 3-(2-hydroxyethyl)-7-[4-(2-methoxyethyl)piperazin-1-yl]quinazolin-4-one |
| SMILES | COCCN1CCN(c2ccc3c(=O)n(CCO)cnc3c2)CC1 |
| InChI | InChI=1S/C17H24N4O3/c1-24-11-9-19-4-6-20(7-5-19)14-2-3-15-16(12-14)18-13-21(8-10-22)17(15)23/h2-3,12-13,22H,4-11H2,1H3 |
| InChIKey | KKIFVWCPDIYUJE-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |