C15H20N4O4S — CID 126898605
3-(2-hydroxyethyl)-7-(4-methylsulfonylpiperazin-1-yl)quinazolin-4-one (PubChem CID 126898605) has the molecular formula C15H20N4O4S and a molecular weight of 352.42 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-7-(4-methylsulfonylpiperazin-1-yl)quinazolin-4-one.
| Compound Name | 3-(2-hydroxyethyl)-7-(4-methylsulfonylpiperazin-1-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 126898605 |
| Molecular Formula | C15H20N4O4S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 3-(2-hydroxyethyl)-7-(4-methylsulfonylpiperazin-1-yl)quinazolin-4-one |
| SMILES | CS(=O)(=O)N1CCN(c2ccc3c(=O)n(CCO)cnc3c2)CC1 |
| InChI | InChI=1S/C15H20N4O4S/c1-24(22,23)19-6-4-17(5-7-19)12-2-3-13-14(10-12)16-11-18(8-9-20)15(13)21/h2-3,10-11,20H,4-9H2,1H3 |
| InChIKey | ATDGGPIWPOGNBY-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |