C21H26N6O2 — CID 126898859
3-(2-hydroxyethyl)-7-[4-(2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]quinazolin-4-one (PubChem CID 126898859) has the molecular formula C21H26N6O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-7-[4-(2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]quinazolin-4-one.
| Compound Name | 3-(2-hydroxyethyl)-7-[4-(2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 126898859 |
| Molecular Formula | C21H26N6O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 3-(2-hydroxyethyl)-7-[4-(2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]quinazolin-4-one |
| SMILES | CC(C)c1nccc(N2CCN(c3ccc4c(=O)n(CCO)cnc4c3)CC2)n1 |
| InChI | InChI=1S/C21H26N6O2/c1-15(2)20-22-6-5-19(24-20)26-9-7-25(8-10-26)16-3-4-17-18(13-16)23-14-27(11-12-28)21(17)29/h3-6,13-15,28H,7-12H2,1-2H3 |
| InChIKey | HQRYWVIXNPLLAW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |