C20H23N5O2 — CID 126898638
3-(2-hydroxyethyl)-7-[4-(2-methyl-4-pyridinyl)piperazin-1-yl]quinazolin-4-one (PubChem CID 126898638) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-7-[4-(2-methyl-4-pyridinyl)piperazin-1-yl]quinazolin-4-one.
| Compound Name | 3-(2-hydroxyethyl)-7-[4-(2-methyl-4-pyridinyl)piperazin-1-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 126898638 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 3-(2-hydroxyethyl)-7-[4-(2-methyl-4-pyridinyl)piperazin-1-yl]quinazolin-4-one |
| SMILES | Cc1cc(N2CCN(c3ccc4c(=O)n(CCO)cnc4c3)CC2)ccn1 |
| InChI | InChI=1S/C20H23N5O2/c1-15-12-17(4-5-21-15)24-8-6-23(7-9-24)16-2-3-18-19(13-16)22-14-25(10-11-26)20(18)27/h2-5,12-14,26H,6-11H2,1H3 |
| InChIKey | OFNUKQPFXPMZMY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |