C20H26N6O2 — CID 126898790
3-(2-hydroxyethyl)-7-[4-[2-(3-methylimidazol-4-yl)ethyl]piperazin-1-yl]quinazolin-4-one (PubChem CID 126898790) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-7-[4-[2-(3-methylimidazol-4-yl)ethyl]piperazin-1-yl]quinazolin-4-one.
| Compound Name | 3-(2-hydroxyethyl)-7-[4-[2-(3-methylimidazol-4-yl)ethyl]piperazin-1-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 126898790 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 3-(2-hydroxyethyl)-7-[4-[2-(3-methylimidazol-4-yl)ethyl]piperazin-1-yl]quinazolin-4-one |
| SMILES | Cn1cncc1CCN1CCN(c2ccc3c(=O)n(CCO)cnc3c2)CC1 |
| InChI | InChI=1S/C20H26N6O2/c1-23-14-21-13-17(23)4-5-24-6-8-25(9-7-24)16-2-3-18-19(12-16)22-15-26(10-11-27)20(18)28/h2-3,12-15,27H,4-11H2,1H3 |
| InChIKey | LTRLLJMFNWOSIM-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |