C20H24N6O2 — CID 126899096
3-(2-methoxyethyl)-7-[4-(3-methylpyrazin-2-yl)piperazin-1-yl]quinazolin-4-one (PubChem CID 126899096) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-7-[4-(3-methylpyrazin-2-yl)piperazin-1-yl]quinazolin-4-one.
| Compound Name | 3-(2-methoxyethyl)-7-[4-(3-methylpyrazin-2-yl)piperazin-1-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 126899096 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 3-(2-methoxyethyl)-7-[4-(3-methylpyrazin-2-yl)piperazin-1-yl]quinazolin-4-one |
| SMILES | COCCn1cnc2cc(N3CCN(c4nccnc4C)CC3)ccc2c1=O |
| InChI | InChI=1S/C20H24N6O2/c1-15-19(22-6-5-21-15)25-9-7-24(8-10-25)16-3-4-17-18(13-16)23-14-26(20(17)27)11-12-28-2/h3-6,13-14H,7-12H2,1-2H3 |
| InChIKey | ZEMDTDVFYXQXHT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |