C22H24N8O2 — CID 126899244
3-(2-methoxyethyl)-7-[4-(6-pyrazol-1-ylpyrazin-2-yl)piperazin-1-yl]quinazolin-4-one (PubChem CID 126899244) has the molecular formula C22H24N8O2 and a molecular weight of 432.49 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-7-[4-(6-pyrazol-1-ylpyrazin-2-yl)piperazin-1-yl]quinazolin-4-one.
| Compound Name | 3-(2-methoxyethyl)-7-[4-(6-pyrazol-1-ylpyrazin-2-yl)piperazin-1-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 126899244 |
| Molecular Formula | C22H24N8O2 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 3-(2-methoxyethyl)-7-[4-(6-pyrazol-1-ylpyrazin-2-yl)piperazin-1-yl]quinazolin-4-one |
| SMILES | COCCn1cnc2cc(N3CCN(c4cncc(-n5cccn5)n4)CC3)ccc2c1=O |
| InChI | InChI=1S/C22H24N8O2/c1-32-12-11-29-16-24-19-13-17(3-4-18(19)22(29)31)27-7-9-28(10-8-27)20-14-23-15-21(26-20)30-6-2-5-25-30/h2-6,13-16H,7-12H2,1H3 |
| InChIKey | FLRRHIVCDALDMZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 94.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |