C21H25N5O2 — CID 126899058
3-(2-methoxyethyl)-7-[4-(pyridin-3-ylmethyl)piperazin-1-yl]quinazolin-4-one (PubChem CID 126899058) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-7-[4-(pyridin-3-ylmethyl)piperazin-1-yl]quinazolin-4-one.
| Compound Name | 3-(2-methoxyethyl)-7-[4-(pyridin-3-ylmethyl)piperazin-1-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 126899058 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 3-(2-methoxyethyl)-7-[4-(pyridin-3-ylmethyl)piperazin-1-yl]quinazolin-4-one |
| SMILES | COCCn1cnc2cc(N3CCN(Cc4cccnc4)CC3)ccc2c1=O |
| InChI | InChI=1S/C21H25N5O2/c1-28-12-11-26-16-23-20-13-18(4-5-19(20)21(26)27)25-9-7-24(8-10-25)15-17-3-2-6-22-14-17/h2-6,13-14,16H,7-12,15H2,1H3 |
| InChIKey | KTTXKGWGDVEQOS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |