C21H30N4O3 — CID 126899210
3-(2-methoxyethyl)-7-[4-(oxan-2-ylmethyl)piperazin-1-yl]quinazolin-4-one (PubChem CID 126899210) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-7-[4-(oxan-2-ylmethyl)piperazin-1-yl]quinazolin-4-one.
| Compound Name | 3-(2-methoxyethyl)-7-[4-(oxan-2-ylmethyl)piperazin-1-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 126899210 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 3-(2-methoxyethyl)-7-[4-(oxan-2-ylmethyl)piperazin-1-yl]quinazolin-4-one |
| SMILES | COCCn1cnc2cc(N3CCN(CC4CCCCO4)CC3)ccc2c1=O |
| InChI | InChI=1S/C21H30N4O3/c1-27-13-11-25-16-22-20-14-17(5-6-19(20)21(25)26)24-9-7-23(8-10-24)15-18-4-2-3-12-28-18/h5-6,14,16,18H,2-4,7-13,15H2,1H3 |
| InChIKey | UQXYRIAXNCJKOS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |