C21H29N5O3 — CID 126899193
3-(2-methoxyethyl)-7-[4-(2-oxoazepan-3-yl)piperazin-1-yl]quinazolin-4-one (PubChem CID 126899193) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-7-[4-(2-oxoazepan-3-yl)piperazin-1-yl]quinazolin-4-one.
| Compound Name | 3-(2-methoxyethyl)-7-[4-(2-oxoazepan-3-yl)piperazin-1-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 126899193 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 3-(2-methoxyethyl)-7-[4-(2-oxoazepan-3-yl)piperazin-1-yl]quinazolin-4-one |
| SMILES | COCCn1cnc2cc(N3CCN(C4CCCCNC4=O)CC3)ccc2c1=O |
| InChI | InChI=1S/C21H29N5O3/c1-29-13-12-26-15-23-18-14-16(5-6-17(18)21(26)28)24-8-10-25(11-9-24)19-4-2-3-7-22-20(19)27/h5-6,14-15,19H,2-4,7-13H2,1H3,(H,22,27) |
| InChIKey | OXUCJFHHWBNSIC-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |