C22H31N5O2 — CID 126897520
7-[4-[(1-acetylpyrrolidin-3-yl)methyl]piperazin-1-yl]-3-propan-2-ylquinazolin-4-one (PubChem CID 126897520) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is 7-[4-[(1-acetylpyrrolidin-3-yl)methyl]piperazin-1-yl]-3-propan-2-ylquinazolin-4-one.
| Compound Name | 7-[4-[(1-acetylpyrrolidin-3-yl)methyl]piperazin-1-yl]-3-propan-2-ylquinazolin-4-one |
|---|---|
| PubChem CID | 126897520 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | 7-[4-[(1-acetylpyrrolidin-3-yl)methyl]piperazin-1-yl]-3-propan-2-ylquinazolin-4-one |
| SMILES | CC(=O)N1CCC(CN2CCN(c3ccc4c(=O)n(C(C)C)cnc4c3)CC2)C1 |
| InChI | InChI=1S/C22H31N5O2/c1-16(2)27-15-23-21-12-19(4-5-20(21)22(27)29)25-10-8-24(9-11-25)13-18-6-7-26(14-18)17(3)28/h4-5,12,15-16,18H,6-11,13-14H2,1-3H3 |
| InChIKey | ANLSKKCYIQWRRE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |