C15H21FN4O2 — CID 126899718
4-(fluoromethyl)-1-[1-(5-methyl-1H-pyrazole-3-carbonyl)piperidin-4-yl]pyrrolidin-2-one (PubChem CID 126899718) has the molecular formula C15H21FN4O2 and a molecular weight of 308.36 g/mol. Its IUPAC name is 4-(fluoromethyl)-1-[1-(5-methyl-1H-pyrazole-3-carbonyl)piperidin-4-yl]pyrrolidin-2-one.
| Compound Name | 4-(fluoromethyl)-1-[1-(5-methyl-1H-pyrazole-3-carbonyl)piperidin-4-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 126899718 |
| Molecular Formula | C15H21FN4O2 |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 4-(fluoromethyl)-1-[1-(5-methyl-1H-pyrazole-3-carbonyl)piperidin-4-yl]pyrrolidin-2-one |
| SMILES | Cc1cc(C(=O)N2CCC(N3CC(CF)CC3=O)CC2)n[nH]1 |
| InChI | InChI=1S/C15H21FN4O2/c1-10-6-13(18-17-10)15(22)19-4-2-12(3-5-19)20-9-11(8-16)7-14(20)21/h6,11-12H,2-5,7-9H2,1H3,(H,17,18) |
| InChIKey | JCMXVLILVWDNGM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |