C22H31N7 — CID 126910639
6-tert-butyl-3-[1-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-ylmethyl)piperidin-4-yl]-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 126910639) has the molecular formula C22H31N7 and a molecular weight of 393.54 g/mol. Its IUPAC name is 6-tert-butyl-3-[1-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-ylmethyl)piperidin-4-yl]-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 6-tert-butyl-3-[1-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-ylmethyl)piperidin-4-yl]-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 126910639 |
| Molecular Formula | C22H31N7 |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | 6-tert-butyl-3-[1-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-2-ylmethyl)piperidin-4-yl]-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | CC(C)(C)c1ccc2nnc(C3CCN(Cc4cc5n(n4)CCCC5)CC3)n2n1 |
| InChI | InChI=1S/C22H31N7/c1-22(2,3)19-7-8-20-23-24-21(29(20)26-19)16-9-12-27(13-10-16)15-17-14-18-6-4-5-11-28(18)25-17/h7-8,14,16H,4-6,9-13,15H2,1-3H3 |
| InChIKey | NQQCBOYJRHLMAX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 64.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |