C21H28N6O2 — CID 126910718
3-[[4-(6-tert-butyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)piperidin-1-yl]methyl]-6,7-dihydro-4H-pyrano[3,4-d][1,2]oxazole (PubChem CID 126910718) has the molecular formula C21H28N6O2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 3-[[4-(6-tert-butyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)piperidin-1-yl]methyl]-6,7-dihydro-4H-pyrano[3,4-d][1,2]oxazole.
| Compound Name | 3-[[4-(6-tert-butyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)piperidin-1-yl]methyl]-6,7-dihydro-4H-pyrano[3,4-d][1,2]oxazole |
|---|---|
| PubChem CID | 126910718 |
| Molecular Formula | C21H28N6O2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 3-[[4-(6-tert-butyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)piperidin-1-yl]methyl]-6,7-dihydro-4H-pyrano[3,4-d][1,2]oxazole |
| SMILES | CC(C)(C)c1ccc2nnc(C3CCN(Cc4noc5c4COCC5)CC3)n2n1 |
| InChI | InChI=1S/C21H28N6O2/c1-21(2,3)18-4-5-19-22-23-20(27(19)24-18)14-6-9-26(10-7-14)12-16-15-13-28-11-8-17(15)29-25-16/h4-5,14H,6-13H2,1-3H3 |
| InChIKey | OIRBIPUVDOEKAV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 81.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |