C19H26N6 — CID 126917924
N-[[1-(6-tert-butylpyridazin-3-yl)azetidin-3-yl]methyl]-3-cyclopropylpyrazin-2-amine (PubChem CID 126917924) has the molecular formula C19H26N6 and a molecular weight of 338.46 g/mol. Its IUPAC name is N-[[1-(6-tert-butylpyridazin-3-yl)azetidin-3-yl]methyl]-3-cyclopropylpyrazin-2-amine.
| Compound Name | N-[[1-(6-tert-butylpyridazin-3-yl)azetidin-3-yl]methyl]-3-cyclopropylpyrazin-2-amine |
|---|---|
| PubChem CID | 126917924 |
| Molecular Formula | C19H26N6 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | N-[[1-(6-tert-butylpyridazin-3-yl)azetidin-3-yl]methyl]-3-cyclopropylpyrazin-2-amine |
| SMILES | CC(C)(C)c1ccc(N2CC(CNc3nccnc3C3CC3)C2)nn1 |
| InChI | InChI=1S/C19H26N6/c1-19(2,3)15-6-7-16(24-23-15)25-11-13(12-25)10-22-18-17(14-4-5-14)20-8-9-21-18/h6-9,13-14H,4-5,10-12H2,1-3H3,(H,21,22) |
| InChIKey | BZPFVXMTWRPXBJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |