C17H23BrN4O — CID 126917866
N-[(5-bromofuran-2-yl)methyl]-1-[1-(6-tert-butylpyridazin-3-yl)azetidin-3-yl]methanamine (PubChem CID 126917866) has the molecular formula C17H23BrN4O and a molecular weight of 379.30 g/mol. Its IUPAC name is N-[(5-bromofuran-2-yl)methyl]-1-[1-(6-tert-butylpyridazin-3-yl)azetidin-3-yl]methanamine.
| Compound Name | N-[(5-bromofuran-2-yl)methyl]-1-[1-(6-tert-butylpyridazin-3-yl)azetidin-3-yl]methanamine |
|---|---|
| PubChem CID | 126917866 |
| Molecular Formula | C17H23BrN4O |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | N-[(5-bromofuran-2-yl)methyl]-1-[1-(6-tert-butylpyridazin-3-yl)azetidin-3-yl]methanamine |
| SMILES | CC(C)(C)c1ccc(N2CC(CNCc3ccc(Br)o3)C2)nn1 |
| InChI | InChI=1S/C17H23BrN4O/c1-17(2,3)14-5-7-16(21-20-14)22-10-12(11-22)8-19-9-13-4-6-15(18)23-13/h4-7,12,19H,8-11H2,1-3H3 |
| InChIKey | ZRZQQRBWMOGJND-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |