C20H22N8 — CID 126921480
2-[methyl-[1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)azetidin-3-yl]amino]-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 126921480) has the molecular formula C20H22N8 and a molecular weight of 374.45 g/mol. Its IUPAC name is 2-[methyl-[1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)azetidin-3-yl]amino]-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-[methyl-[1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)azetidin-3-yl]amino]-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 126921480 |
| Molecular Formula | C20H22N8 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 2-[methyl-[1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)azetidin-3-yl]amino]-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | Cc1nnc2ccc(N3CC(N(C)c4nc5c(cc4C#N)CCCC5)C3)nn12 |
| InChI | InChI=1S/C20H22N8/c1-13-23-24-18-7-8-19(25-28(13)18)27-11-16(12-27)26(2)20-15(10-21)9-14-5-3-4-6-17(14)22-20/h7-9,16H,3-6,11-12H2,1-2H3 |
| InChIKey | TUURXYYSFTYLNK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 86.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |