C19H29N5O — CID 126924089
6-tert-butyl-2-[[1-[2-(3-methylimidazol-4-yl)ethyl]pyrrolidin-2-yl]methyl]pyridazin-3-one (PubChem CID 126924089) has the molecular formula C19H29N5O and a molecular weight of 343.48 g/mol. Its IUPAC name is 6-tert-butyl-2-[[1-[2-(3-methylimidazol-4-yl)ethyl]pyrrolidin-2-yl]methyl]pyridazin-3-one.
| Compound Name | 6-tert-butyl-2-[[1-[2-(3-methylimidazol-4-yl)ethyl]pyrrolidin-2-yl]methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 126924089 |
| Molecular Formula | C19H29N5O |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | 6-tert-butyl-2-[[1-[2-(3-methylimidazol-4-yl)ethyl]pyrrolidin-2-yl]methyl]pyridazin-3-one |
| SMILES | Cn1cncc1CCN1CCCC1Cn1nc(C(C)(C)C)ccc1=O |
| InChI | InChI=1S/C19H29N5O/c1-19(2,3)17-7-8-18(25)24(21-17)13-16-6-5-10-23(16)11-9-15-12-20-14-22(15)4/h7-8,12,14,16H,5-6,9-11,13H2,1-4H3 |
| InChIKey | XDOZNYJXBLGOKA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |