C17H26N6O — CID 126924066
6-tert-butyl-2-[[1-[2-(triazol-1-yl)ethyl]pyrrolidin-2-yl]methyl]pyridazin-3-one (PubChem CID 126924066) has the molecular formula C17H26N6O and a molecular weight of 330.44 g/mol. Its IUPAC name is 6-tert-butyl-2-[[1-[2-(triazol-1-yl)ethyl]pyrrolidin-2-yl]methyl]pyridazin-3-one.
| Compound Name | 6-tert-butyl-2-[[1-[2-(triazol-1-yl)ethyl]pyrrolidin-2-yl]methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 126924066 |
| Molecular Formula | C17H26N6O |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 6-tert-butyl-2-[[1-[2-(triazol-1-yl)ethyl]pyrrolidin-2-yl]methyl]pyridazin-3-one |
| SMILES | CC(C)(C)c1ccc(=O)n(CC2CCCN2CCn2ccnn2)n1 |
| InChI | InChI=1S/C17H26N6O/c1-17(2,3)15-6-7-16(24)23(19-15)13-14-5-4-9-21(14)11-12-22-10-8-18-20-22/h6-8,10,14H,4-5,9,11-13H2,1-3H3 |
| InChIKey | VJGIXVCFFMJXKV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |