C19H22N6O3 — CID 126932656
5-[2-(6-cyclopropylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-3-methyl-1H-pyrimidine-2,4-dione (PubChem CID 126932656) has the molecular formula C19H22N6O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is 5-[2-(6-cyclopropylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-3-methyl-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[2-(6-cyclopropylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-3-methyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 126932656 |
| Molecular Formula | C19H22N6O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 5-[2-(6-cyclopropylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-3-methyl-1H-pyrimidine-2,4-dione |
| SMILES | Cn1c(=O)[nH]cc(C(=O)N2CC3CN(c4cc(C5CC5)ncn4)CC3C2)c1=O |
| InChI | InChI=1S/C19H22N6O3/c1-23-17(26)14(5-20-19(23)28)18(27)25-8-12-6-24(7-13(12)9-25)16-4-15(11-2-3-11)21-10-22-16/h4-5,10-13H,2-3,6-9H2,1H3,(H,20,28) |
| InChIKey | GHOGOOPITJXCDJ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |