C22H25N5 — CID 126933710
4-[[5-(6-cyclobutylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]benzonitrile (PubChem CID 126933710) has the molecular formula C22H25N5 and a molecular weight of 359.48 g/mol. Its IUPAC name is 4-[[5-(6-cyclobutylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]benzonitrile.
| Compound Name | 4-[[5-(6-cyclobutylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 126933710 |
| Molecular Formula | C22H25N5 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 4-[[5-(6-cyclobutylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2CC3CN(c4cc(C5CCC5)ncn4)CC3C2)cc1 |
| InChI | InChI=1S/C22H25N5/c23-9-16-4-6-17(7-5-16)10-26-11-19-13-27(14-20(19)12-26)22-8-21(24-15-25-22)18-2-1-3-18/h4-8,15,18-20H,1-3,10-14H2 |
| InChIKey | ZCPWMBJVHRYRDE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 56.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |