C14H17N7O — CID 126933874
[2-(5-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1H-1,2,4-triazol-5-yl)methanone (PubChem CID 126933874) has the molecular formula C14H17N7O and a molecular weight of 299.34 g/mol. Its IUPAC name is [2-(5-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1H-1,2,4-triazol-5-yl)methanone.
| Compound Name | [2-(5-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1H-1,2,4-triazol-5-yl)methanone |
|---|---|
| PubChem CID | 126933874 |
| Molecular Formula | C14H17N7O |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | [2-(5-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1H-1,2,4-triazol-5-yl)methanone |
| SMILES | Cc1cncnc1N1CC2CN(C(=O)c3ncn[nH]3)CC2C1 |
| InChI | InChI=1S/C14H17N7O/c1-9-2-15-7-17-13(9)20-3-10-5-21(6-11(10)4-20)14(22)12-16-8-18-19-12/h2,7-8,10-11H,3-6H2,1H3,(H,16,18,19) |
| InChIKey | XDJFBPTXVGGHEI-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |