C18H21N7 — CID 126934198
6-methyl-4-[2-(5-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5H-pyrrolo[3,2-d]pyrimidine (PubChem CID 126934198) has the molecular formula C18H21N7 and a molecular weight of 335.41 g/mol. Its IUPAC name is 6-methyl-4-[2-(5-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5H-pyrrolo[3,2-d]pyrimidine.
| Compound Name | 6-methyl-4-[2-(5-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5H-pyrrolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 126934198 |
| Molecular Formula | C18H21N7 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 6-methyl-4-[2-(5-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5H-pyrrolo[3,2-d]pyrimidine |
| SMILES | Cc1cc2ncnc(N3CC4CN(c5ncncc5C)CC4C3)c2[nH]1 |
| InChI | InChI=1S/C18H21N7/c1-11-4-19-9-21-17(11)24-5-13-7-25(8-14(13)6-24)18-16-15(20-10-22-18)3-12(2)23-16/h3-4,9-10,13-14,23H,5-8H2,1-2H3 |
| InChIKey | XAYPYBMNYWPYGH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |