C15H20N6S — CID 126934063
2-methyl-5-[[5-(5-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-1,3,4-thiadiazole (PubChem CID 126934063) has the molecular formula C15H20N6S and a molecular weight of 316.43 g/mol. Its IUPAC name is 2-methyl-5-[[5-(5-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-1,3,4-thiadiazole.
| Compound Name | 2-methyl-5-[[5-(5-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 126934063 |
| Molecular Formula | C15H20N6S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 2-methyl-5-[[5-(5-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-1,3,4-thiadiazole |
| SMILES | Cc1nnc(CN2CC3CN(c4ncncc4C)CC3C2)s1 |
| InChI | InChI=1S/C15H20N6S/c1-10-3-16-9-17-15(10)21-6-12-4-20(5-13(12)7-21)8-14-19-18-11(2)22-14/h3,9,12-13H,4-8H2,1-2H3 |
| InChIKey | AZYQSBNWDWMUKQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |