C18H26N6S — CID 126932481
2-[[5-(6-tert-butylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-5-methyl-1,3,4-thiadiazole (PubChem CID 126932481) has the molecular formula C18H26N6S and a molecular weight of 358.52 g/mol. Its IUPAC name is 2-[[5-(6-tert-butylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-5-methyl-1,3,4-thiadiazole.
| Compound Name | 2-[[5-(6-tert-butylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-5-methyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 126932481 |
| Molecular Formula | C18H26N6S |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 2-[[5-(6-tert-butylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-5-methyl-1,3,4-thiadiazole |
| SMILES | Cc1nnc(CN2CC3CN(c4cc(C(C)(C)C)ncn4)CC3C2)s1 |
| InChI | InChI=1S/C18H26N6S/c1-12-21-22-17(25-12)10-23-6-13-8-24(9-14(13)7-23)16-5-15(18(2,3)4)19-11-20-16/h5,11,13-14H,6-10H2,1-4H3 |
| InChIKey | DSZPNBSDBWDJRS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |