C18H27N7 — CID 126932492
5-(6-tert-butylpyrimidin-4-yl)-2-[(3-methyltriazol-4-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 126932492) has the molecular formula C18H27N7 and a molecular weight of 341.46 g/mol. Its IUPAC name is 5-(6-tert-butylpyrimidin-4-yl)-2-[(3-methyltriazol-4-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-(6-tert-butylpyrimidin-4-yl)-2-[(3-methyltriazol-4-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 126932492 |
| Molecular Formula | C18H27N7 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.23 |
| IUPAC Name | 5-(6-tert-butylpyrimidin-4-yl)-2-[(3-methyltriazol-4-yl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | Cn1nncc1CN1CC2CN(c3cc(C(C)(C)C)ncn3)CC2C1 |
| InChI | InChI=1S/C18H27N7/c1-18(2,3)16-5-17(20-12-19-16)25-9-13-7-24(8-14(13)10-25)11-15-6-21-22-23(15)4/h5-6,12-14H,7-11H2,1-4H3 |
| InChIKey | IAPLGHKLLTZJFF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |