C20H28N6O — CID 126932331
[2-(6-tert-butylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,5-dimethylpyrazol-3-yl)methanone (PubChem CID 126932331) has the molecular formula C20H28N6O and a molecular weight of 368.49 g/mol. Its IUPAC name is [2-(6-tert-butylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,5-dimethylpyrazol-3-yl)methanone.
| Compound Name | [2-(6-tert-butylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,5-dimethylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 126932331 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | [2-(6-tert-butylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,5-dimethylpyrazol-3-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CC3CN(c4cc(C(C)(C)C)ncn4)CC3C2)n(C)n1 |
| InChI | InChI=1S/C20H28N6O/c1-13-6-16(24(5)23-13)19(27)26-10-14-8-25(9-15(14)11-26)18-7-17(20(2,3)4)21-12-22-18/h6-7,12,14-15H,8-11H2,1-5H3 |
| InChIKey | MVXKKDHBBXEUJX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |