C22H30N6O2 — CID 126932338
6-[2-(6-tert-butylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-2-propan-2-ylpyridazin-3-one (PubChem CID 126932338) has the molecular formula C22H30N6O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 6-[2-(6-tert-butylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-2-propan-2-ylpyridazin-3-one.
| Compound Name | 6-[2-(6-tert-butylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-2-propan-2-ylpyridazin-3-one |
|---|---|
| PubChem CID | 126932338 |
| Molecular Formula | C22H30N6O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 6-[2-(6-tert-butylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-2-propan-2-ylpyridazin-3-one |
| SMILES | CC(C)n1nc(C(=O)N2CC3CN(c4cc(C(C)(C)C)ncn4)CC3C2)ccc1=O |
| InChI | InChI=1S/C22H30N6O2/c1-14(2)28-20(29)7-6-17(25-28)21(30)27-11-15-9-26(10-16(15)12-27)19-8-18(22(3,4)5)23-13-24-19/h6-8,13-16H,9-12H2,1-5H3 |
| InChIKey | ZONTYFHIPPJGHP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |