C18H23N5OS — CID 126932335
[2-(6-tert-butylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1,3-thiazol-4-yl)methanone (PubChem CID 126932335) has the molecular formula C18H23N5OS and a molecular weight of 357.48 g/mol. Its IUPAC name is [2-(6-tert-butylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1,3-thiazol-4-yl)methanone.
| Compound Name | [2-(6-tert-butylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 126932335 |
| Molecular Formula | C18H23N5OS |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | [2-(6-tert-butylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1,3-thiazol-4-yl)methanone |
| SMILES | CC(C)(C)c1cc(N2CC3CN(C(=O)c4cscn4)CC3C2)ncn1 |
| InChI | InChI=1S/C18H23N5OS/c1-18(2,3)15-4-16(20-10-19-15)22-5-12-7-23(8-13(12)6-22)17(24)14-9-25-11-21-14/h4,9-13H,5-8H2,1-3H3 |
| InChIKey | AYPUAHNFXUNHPY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |