C16H17N7OS — CID 155798968
[2-(9-methylpurin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1,3-thiazol-4-yl)methanone (PubChem CID 155798968) has the molecular formula C16H17N7OS and a molecular weight of 355.43 g/mol. Its IUPAC name is [2-(9-methylpurin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1,3-thiazol-4-yl)methanone.
| Compound Name | [2-(9-methylpurin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 155798968 |
| Molecular Formula | C16H17N7OS |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | [2-(9-methylpurin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1,3-thiazol-4-yl)methanone |
| SMILES | Cn1cnc2c(N3CC4CN(C(=O)c5cscn5)CC4C3)ncnc21 |
| InChI | InChI=1S/C16H17N7OS/c1-21-8-19-13-14(21)17-7-18-15(13)22-2-10-4-23(5-11(10)3-22)16(24)12-6-25-9-20-12/h6-11H,2-5H2,1H3 |
| InChIKey | WLYXPPSXAHLJEN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |