C15H16N4OS — CID 97386153
[(3aR,6aS)-2-pyridin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1,3-thiazol-4-yl)methanone (PubChem CID 97386153) has the molecular formula C15H16N4OS and a molecular weight of 300.39 g/mol. Its IUPAC name is [(3aR,6aS)-2-pyridin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1,3-thiazol-4-yl)methanone.
| Compound Name | [(3aR,6aS)-2-pyridin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 97386153 |
| Molecular Formula | C15H16N4OS |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | [(3aR,6aS)-2-pyridin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1cscn1)N1C[C@@H]2CN(c3ccccn3)C[C@@H]2C1 |
| InChI | InChI=1S/C15H16N4OS/c20-15(13-9-21-10-17-13)19-7-11-5-18(6-12(11)8-19)14-3-1-2-4-16-14/h1-4,9-12H,5-8H2/t11-,12+ |
| InChIKey | FYGGWPPTMDKCFW-TXEJJXNPSA-N |
| XLogP | 1.75 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |