C18H18F3N5O — CID 126858134
[2-(6-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone (PubChem CID 126858134) has the molecular formula C18H18F3N5O and a molecular weight of 377.37 g/mol. Its IUPAC name is [2-(6-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone.
| Compound Name | [2-(6-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 126858134 |
| Molecular Formula | C18H18F3N5O |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | [2-(6-methylpyrimidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
| SMILES | Cc1cc(N2CC3CN(C(=O)c4ccc(C(F)(F)F)nc4)CC3C2)ncn1 |
| InChI | InChI=1S/C18H18F3N5O/c1-11-4-16(24-10-23-11)25-6-13-8-26(9-14(13)7-25)17(27)12-2-3-15(22-5-12)18(19,20)21/h2-5,10,13-14H,6-9H2,1H3 |
| InChIKey | IOIXRIWBBJXNKL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |